C20H30N2O3 — CID 58697208
(E)-1-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 58697208) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (E)-1-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 58697208 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (E)-1-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCN(CC)C[C@@H]1CCCN1C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H30N2O3/c1-5-21(6-2)15-17-8-7-13-22(17)20(23)12-10-16-9-11-18(24-3)19(14-16)25-4/h9-12,14,17H,5-8,13,15H2,1-4H3/b12-10+/t17-/m0/s1 |
| InChIKey | JXORMXDYEFRUIB-JICACKBISA-N |
| XLogP | 3.05 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|