C15H20ClFN2O2 — CID 122148051
(E)-1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(3-fluoro-4-methoxyphenyl)prop-2-en-1-one;hydrochloride (PubChem CID 122148051) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is (E)-1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(3-fluoro-4-methoxyphenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(3-fluoro-4-methoxyphenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 122148051 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (E)-1-[2-(aminomethyl)pyrrolidin-1-yl]-3-(3-fluoro-4-methoxyphenyl)prop-2-en-1-one;hydrochloride |
| SMILES | COc1ccc(/C=C/C(=O)N2CCCC2CN)cc1F.Cl |
| InChI | InChI=1S/C15H19FN2O2.ClH/c1-20-14-6-4-11(9-13(14)16)5-7-15(19)18-8-2-3-12(18)10-17;/h4-7,9,12H,2-3,8,10,17H2,1H3;1H/b7-5+; |
| InChIKey | ARFBZCQCEUPUMO-GZOLSCHFSA-N |
| XLogP | 2.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|