C24H29NO4 — CID 9291540
(E)-3-(3,4-dimethoxyphenyl)-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]prop-2-en-1-one (PubChem CID 9291540) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9291540 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc([C@@H]2CCCCCN2C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-27-20-12-10-19(11-13-20)21-7-5-4-6-16-25(21)24(26)15-9-18-8-14-22(28-2)23(17-18)29-3/h8-15,17,21H,4-7,16H2,1-3H3/b15-9+/t21-/m0/s1 |
| InChIKey | HMRHJLLDRCIBOR-NMQRCDEWSA-N |
| XLogP | 4.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|