C23H23N3O2 — CID 24513474
(E)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 24513474) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (E)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24513474 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (E)-1-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-3-(1-phenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C2CCCN2C(=O)/C=C/c2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-28-21-12-10-19(11-13-21)22-8-5-15-25(22)23(27)14-9-18-16-24-26(17-18)20-6-3-2-4-7-20/h2-4,6-7,9-14,16-17,22H,5,8,15H2,1H3/b14-9+ |
| InChIKey | FETGGMGIZWFRMG-NTEUORMPSA-N |
| XLogP | 4.26 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|