C22H22N2O3 — CID 51318894
2-[2-methoxy-4-[(E)-3-oxo-3-(2-phenylpyrrolidin-1-yl)prop-1-enyl]phenoxy]acetonitrile (PubChem CID 51318894) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-oxo-3-(2-phenylpyrrolidin-1-yl)prop-1-enyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[(E)-3-oxo-3-(2-phenylpyrrolidin-1-yl)prop-1-enyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 51318894 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-oxo-3-(2-phenylpyrrolidin-1-yl)prop-1-enyl]phenoxy]acetonitrile |
| SMILES | COc1cc(/C=C/C(=O)N2CCCC2c2ccccc2)ccc1OCC#N |
| InChI | InChI=1S/C22H22N2O3/c1-26-21-16-17(9-11-20(21)27-15-13-23)10-12-22(25)24-14-5-8-19(24)18-6-3-2-4-7-18/h2-4,6-7,9-12,16,19H,5,8,14-15H2,1H3/b12-10+ |
| InChIKey | AATRXZQPGPYFGJ-ZRDIBKRKSA-N |
| XLogP | 3.97 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|