C26H29N3O4 — CID 36560540
2-[2-methoxy-4-[(E)-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]acetonitrile (PubChem CID 36560540) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[(E)-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 36560540 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]acetonitrile |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(C(=O)C(C)(C)c3ccccc3)CC2)ccc1OCC#N |
| InChI | InChI=1S/C26H29N3O4/c1-26(2,21-7-5-4-6-8-21)25(31)29-16-14-28(15-17-29)24(30)12-10-20-9-11-22(33-18-13-27)23(19-20)32-3/h4-12,19H,14-18H2,1-3H3/b12-10+ |
| InChIKey | MHWXFXZPSVHLSE-ZRDIBKRKSA-N |
| XLogP | 3.26 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|