C22H32N2O7 — CID 141060753
methyl 4-(hexanoylamino)-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate (PubChem CID 141060753) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 4-(hexanoylamino)-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(hexanoylamino)-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141060753 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl 4-(hexanoylamino)-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCCCCC(=O)NC1CC(C(=O)OC)N(C(=O)c2cc(OC)c(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C22H32N2O7/c1-6-7-8-9-19(25)23-15-12-16(22(27)31-5)24(13-15)21(26)14-10-17(28-2)20(30-4)18(11-14)29-3/h10-11,15-16H,6-9,12-13H2,1-5H3,(H,23,25) |
| InChIKey | UONQIGYPNZWOHF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|