C32H46N4O9 — CID 3013154
3-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-1,1-dipropylurea (PubChem CID 3013154) has the molecular formula C32H46N4O9 and a molecular weight of 630.74 g/mol. Its IUPAC name is 3-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-1,1-dipropylurea.
| Compound Name | 3-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 3013154 |
| Molecular Formula | C32H46N4O9 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | 3-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCC1CN(C(=O)c2cc(OC)c(OC)c(OC)c2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H46N4O9/c1-9-11-34(12-10-2)32(39)33-19-23-20-35(30(37)21-15-24(40-3)28(44-7)25(16-21)41-4)13-14-36(23)31(38)22-17-26(42-5)29(45-8)27(18-22)43-6/h15-18,23H,9-14,19-20H2,1-8H3,(H,33,39) |
| InChIKey | JDYDOYUOUCWEHP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |