C34H42N4O9 — CID 3013156
1-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-3-(2,6-dimethylphenyl)urea (PubChem CID 3013156) has the molecular formula C34H42N4O9 and a molecular weight of 650.73 g/mol. Its IUPAC name is 1-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 3013156 |
| Molecular Formula | C34H42N4O9 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | 1-[[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl]-3-(2,6-dimethylphenyl)urea |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)C(CNC(=O)Nc3c(C)cccc3C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C34H42N4O9/c1-20-10-9-11-21(2)29(20)36-34(41)35-18-24-19-37(32(39)22-14-25(42-3)30(46-7)26(15-22)43-4)12-13-38(24)33(40)23-16-27(44-5)31(47-8)28(17-23)45-6/h9-11,14-17,24H,12-13,18-19H2,1-8H3,(H2,35,36,41) |
| InChIKey | KWPVNQRLSINHKT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |