C27H37N3O5 — CID 27850735
N-(2,6-dimethylphenyl)-2-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 27850735) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27850735 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCOc1cc(C(=O)N2CCN(CC(=O)Nc3c(C)cccc3C)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H37N3O5/c1-6-33-22-16-21(17-23(34-7-2)26(22)35-8-3)27(32)30-14-12-29(13-15-30)18-24(31)28-25-19(4)10-9-11-20(25)5/h9-11,16-17H,6-8,12-15,18H2,1-5H3,(H,28,31) |
| InChIKey | SMRLEOCZKFLFPA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |