C25H31N3O4 — CID 24547645
N-(2,6-dimethylphenyl)-2-[4-(3-methoxy-4-prop-2-enoxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 24547645) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(3-methoxy-4-prop-2-enoxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(3-methoxy-4-prop-2-enoxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24547645 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(3-methoxy-4-prop-2-enoxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | C=CCOc1ccc(C(=O)N2CCN(CC(=O)Nc3c(C)cccc3C)CC2)cc1OC |
| InChI | InChI=1S/C25H31N3O4/c1-5-15-32-21-10-9-20(16-22(21)31-4)25(30)28-13-11-27(12-14-28)17-23(29)26-24-18(2)7-6-8-19(24)3/h5-10,16H,1,11-15,17H2,2-4H3,(H,26,29) |
| InChIKey | CCESBTYHBYWKST-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|