C23H28N2O3 — CID 27259483
[4-(2,3-dimethylphenyl)piperazin-1-yl]-(3-methoxy-4-prop-2-enoxyphenyl)methanone (PubChem CID 27259483) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)piperazin-1-yl]-(3-methoxy-4-prop-2-enoxyphenyl)methanone.
| Compound Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(3-methoxy-4-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 27259483 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(3-methoxy-4-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccc(C(=O)N2CCN(c3cccc(C)c3C)CC2)cc1OC |
| InChI | InChI=1S/C23H28N2O3/c1-5-15-28-21-10-9-19(16-22(21)27-4)23(26)25-13-11-24(12-14-25)20-8-6-7-17(2)18(20)3/h5-10,16H,1,11-15H2,2-4H3 |
| InChIKey | QJMCEEOBPJSJFP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|