C19H23N3O — CID 28722555
(4-aminophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 28722555) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (4-aminophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 28722555 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (4-aminophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(N)cc3)CC2)c1C |
| InChI | InChI=1S/C19H23N3O/c1-14-4-3-5-18(15(14)2)21-10-12-22(13-11-21)19(23)16-6-8-17(20)9-7-16/h3-9H,10-13,20H2,1-2H3 |
| InChIKey | QJQRLAMDGJTRRW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|