C19H20Cl2N2O — CID 26881725
(3,5-dichlorophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 26881725) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26881725 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3cc(Cl)cc(Cl)c3)CC2)c1C |
| InChI | InChI=1S/C19H20Cl2N2O/c1-13-4-3-5-18(14(13)2)22-6-8-23(9-7-22)19(24)15-10-16(20)12-17(21)11-15/h3-5,10-12H,6-9H2,1-2H3 |
| InChIKey | JZCSYVUTVUZVIE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |