C24H31N3O2 — CID 109044078
N-butan-2-yl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]benzamide (PubChem CID 109044078) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-butan-2-yl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]benzamide.
| Compound Name | N-butan-2-yl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 109044078 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-butan-2-yl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]benzamide |
| SMILES | CCC(C)NC(=O)c1ccc(C(=O)N2CCN(c3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-5-18(3)25-23(28)20-9-11-21(12-10-20)24(29)27-15-13-26(14-16-27)22-8-6-7-17(2)19(22)4/h6-12,18H,5,13-16H2,1-4H3,(H,25,28) |
| InChIKey | AHSCBOVIAQXVBY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |