C17H25N3O5S — CID 32504642
4-(3-methoxy-4-prop-2-enoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 32504642) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-(3-methoxy-4-prop-2-enoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(3-methoxy-4-prop-2-enoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 32504642 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-(3-methoxy-4-prop-2-enoxybenzoyl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | C=CCOc1ccc(C(=O)N2CCN(S(=O)(=O)N(C)C)CC2)cc1OC |
| InChI | InChI=1S/C17H25N3O5S/c1-5-12-25-15-7-6-14(13-16(15)24-4)17(21)19-8-10-20(11-9-19)26(22,23)18(2)3/h5-7,13H,1,8-12H2,2-4H3 |
| InChIKey | LOMUQRYIXLFBPL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|