C31H32N4O5 — CID 136817919
3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one (PubChem CID 136817919) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136817919 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-1H-quinoxalin-2-one |
| SMILES | COc1ccc(C(O)=Cc2nc3ccc(C(=O)N4CCN(c5cccc(C)c5C)CC4)cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C31H32N4O5/c1-19-6-5-7-26(20(19)2)34-12-14-35(15-13-34)31(38)22-8-10-23-24(16-22)33-30(37)25(32-23)18-27(36)21-9-11-28(39-3)29(17-21)40-4/h5-11,16-18,36H,12-15H2,1-4H3,(H,33,37) |
| InChIKey | JYXZIBXDKMVRDF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|