C23H23N3O6 — CID 136727434
3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-(morpholine-4-carbonyl)-1H-quinoxalin-2-one (PubChem CID 136727434) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-(morpholine-4-carbonyl)-1H-quinoxalin-2-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-(morpholine-4-carbonyl)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 136727434 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-2-hydroxyethenyl]-7-(morpholine-4-carbonyl)-1H-quinoxalin-2-one |
| SMILES | COc1ccc(C(O)=Cc2nc3ccc(C(=O)N4CCOCC4)cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C23H23N3O6/c1-30-20-6-4-14(12-21(20)31-2)19(27)13-18-22(28)25-17-11-15(3-5-16(17)24-18)23(29)26-7-9-32-10-8-26/h3-6,11-13,27H,7-10H2,1-2H3,(H,25,28) |
| InChIKey | DRQFTYKPRINVID-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|