C13H14N2O3S — CID 177077642
(2-methoxy-1,3-benzothiazol-6-yl)-morpholin-4-ylmethanone (PubChem CID 177077642) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is (2-methoxy-1,3-benzothiazol-6-yl)-morpholin-4-ylmethanone.
| Compound Name | (2-methoxy-1,3-benzothiazol-6-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 177077642 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (2-methoxy-1,3-benzothiazol-6-yl)-morpholin-4-ylmethanone |
| SMILES | COc1nc2ccc(C(=O)N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C13H14N2O3S/c1-17-13-14-10-3-2-9(8-11(10)19-13)12(16)15-4-6-18-7-5-15/h2-3,8H,4-7H2,1H3 |
| InChIKey | CVFVDHUIRFSEMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |