C14H16N2OS — CID 3581764
(2-methyl-1,3-benzothiazol-6-yl)-piperidin-1-ylmethanone (PubChem CID 3581764) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is (2-methyl-1,3-benzothiazol-6-yl)-piperidin-1-ylmethanone.
| Compound Name | (2-methyl-1,3-benzothiazol-6-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 3581764 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2-methyl-1,3-benzothiazol-6-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1nc2ccc(C(=O)N3CCCCC3)cc2s1 |
| InChI | InChI=1S/C14H16N2OS/c1-10-15-12-6-5-11(9-13(12)18-10)14(17)16-7-3-2-4-8-16/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | KMCDEDNTISQMFO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |