C15H17N3O — CID 170073145
(3-methylquinoxalin-6-yl)-piperidin-1-ylmethanone (PubChem CID 170073145) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is (3-methylquinoxalin-6-yl)-piperidin-1-ylmethanone.
| Compound Name | (3-methylquinoxalin-6-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 170073145 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (3-methylquinoxalin-6-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1cnc2ccc(C(=O)N3CCCCC3)cc2n1 |
| InChI | InChI=1S/C15H17N3O/c1-11-10-16-13-6-5-12(9-14(13)17-11)15(19)18-7-3-2-4-8-18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | OYSQFCRIQIHSRN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |