C18H23N3O — CID 47009187
azocan-1-yl-(2,3-dimethylquinoxalin-6-yl)methanone (PubChem CID 47009187) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is azocan-1-yl-(2,3-dimethylquinoxalin-6-yl)methanone.
| Compound Name | azocan-1-yl-(2,3-dimethylquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 47009187 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | azocan-1-yl-(2,3-dimethylquinoxalin-6-yl)methanone |
| SMILES | Cc1nc2ccc(C(=O)N3CCCCCCC3)cc2nc1C |
| InChI | InChI=1S/C18H23N3O/c1-13-14(2)20-17-12-15(8-9-16(17)19-13)18(22)21-10-6-4-3-5-7-11-21/h8-9,12H,3-7,10-11H2,1-2H3 |
| InChIKey | XKUVMFNWBJRYGY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |