C17H20N4O2 — CID 94457790
(3S)-1-(2,3-dimethylquinoxaline-6-carbonyl)piperidine-3-carboxamide (PubChem CID 94457790) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3S)-1-(2,3-dimethylquinoxaline-6-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2,3-dimethylquinoxaline-6-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94457790 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3S)-1-(2,3-dimethylquinoxaline-6-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)N3CCC[C@H](C(N)=O)C3)cc2nc1C |
| InChI | InChI=1S/C17H20N4O2/c1-10-11(2)20-15-8-12(5-6-14(15)19-10)17(23)21-7-3-4-13(9-21)16(18)22/h5-6,8,13H,3-4,7,9H2,1-2H3,(H2,18,22)/t13-/m0/s1 |
| InChIKey | CYCFYVRTZVPCRX-ZDUSSCGKSA-N |
| XLogP | 1.58 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |