C17H21N3O2 — CID 94784044
(3R)-1-(2,3-dimethyl-1H-indole-5-carbonyl)piperidine-3-carboxamide (PubChem CID 94784044) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3R)-1-(2,3-dimethyl-1H-indole-5-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2,3-dimethyl-1H-indole-5-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94784044 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (3R)-1-(2,3-dimethyl-1H-indole-5-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCC[C@@H](C(N)=O)C3)cc2c1C |
| InChI | InChI=1S/C17H21N3O2/c1-10-11(2)19-15-6-5-12(8-14(10)15)17(22)20-7-3-4-13(9-20)16(18)21/h5-6,8,13,19H,3-4,7,9H2,1-2H3,(H2,18,21)/t13-/m1/s1 |
| InChIKey | ZHHPLRFULJLZQW-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|