C17H22N2O2 — CID 114680498
(2,3-dimethyl-1H-indol-5-yl)-(4-hydroxy-3-methylpiperidin-1-yl)methanone (PubChem CID 114680498) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-(4-hydroxy-3-methylpiperidin-1-yl)methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-(4-hydroxy-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114680498 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-(4-hydroxy-3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCC(O)C(C)C3)cc2c1C |
| InChI | InChI=1S/C17H22N2O2/c1-10-9-19(7-6-16(10)20)17(21)13-4-5-15-14(8-13)11(2)12(3)18-15/h4-5,8,10,16,18,20H,6-7,9H2,1-3H3 |
| InChIKey | LGJHWZNIWMPXEQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|