C17H22N2O — CID 43397948
(2,3-dimethyl-1H-indol-5-yl)-(2-methylpiperidin-1-yl)methanone (PubChem CID 43397948) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-(2-methylpiperidin-1-yl)methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 43397948 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-(2-methylpiperidin-1-yl)methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCCCC3C)cc2c1C |
| InChI | InChI=1S/C17H22N2O/c1-11-6-4-5-9-19(11)17(20)14-7-8-16-15(10-14)12(2)13(3)18-16/h7-8,10-11,18H,4-6,9H2,1-3H3 |
| InChIKey | GODSUZFOAYRBPJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|