C20H21N3O — CID 39490617
(2,3-dimethyl-1H-indol-5-yl)-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]methanone (PubChem CID 39490617) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 39490617 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(2R)-2-pyridin-3-ylpyrrolidin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCC[C@@H]3c3cccnc3)cc2c1C |
| InChI | InChI=1S/C20H21N3O/c1-13-14(2)22-18-8-7-15(11-17(13)18)20(24)23-10-4-6-19(23)16-5-3-9-21-12-16/h3,5,7-9,11-12,19,22H,4,6,10H2,1-2H3/t19-/m1/s1 |
| InChIKey | MHHYEKCRCADZPY-LJQANCHMSA-N |
| XLogP | 4.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|