C22H25N3O — CID 37332978
(2,3-dimethyl-1H-indol-5-yl)-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone (PubChem CID 37332978) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 37332978 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCN(C)C[C@@H]3c3ccccc3)cc2c1C |
| InChI | InChI=1S/C22H25N3O/c1-15-16(2)23-20-10-9-18(13-19(15)20)22(26)25-12-11-24(3)14-21(25)17-7-5-4-6-8-17/h4-10,13,21,23H,11-12,14H2,1-3H3/t21-/m1/s1 |
| InChIKey | LVGLAVZGBIJDAN-OAQYLSRUSA-N |
| XLogP | 3.91 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|