C21H23N3O — CID 131934792
(2-pyridin-3-ylpyrrolidin-1-yl)-(3,5,7-trimethyl-1H-indol-2-yl)methanone (PubChem CID 131934792) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is (2-pyridin-3-ylpyrrolidin-1-yl)-(3,5,7-trimethyl-1H-indol-2-yl)methanone.
| Compound Name | (2-pyridin-3-ylpyrrolidin-1-yl)-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 131934792 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (2-pyridin-3-ylpyrrolidin-1-yl)-(3,5,7-trimethyl-1H-indol-2-yl)methanone |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)N3CCCC3c3cccnc3)c(C)c2c1 |
| InChI | InChI=1S/C21H23N3O/c1-13-10-14(2)19-17(11-13)15(3)20(23-19)21(25)24-9-5-7-18(24)16-6-4-8-22-12-16/h4,6,8,10-12,18,23H,5,7,9H2,1-3H3 |
| InChIKey | QJJASLOGXLPXBT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|