C16H21N3O — CID 65418753
(2,3-dimethyl-1H-indol-5-yl)-(3-methylpiperazin-1-yl)methanone (PubChem CID 65418753) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-(3-methylpiperazin-1-yl)methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 65418753 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-(3-methylpiperazin-1-yl)methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCNC(C)C3)cc2c1C |
| InChI | InChI=1S/C16H21N3O/c1-10-9-19(7-6-17-10)16(20)13-4-5-15-14(8-13)11(2)12(3)18-15/h4-5,8,10,17-18H,6-7,9H2,1-3H3 |
| InChIKey | SJAIFNFTHJRMLI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|