C20H26N2O3 — CID 129491728
(2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-[(1S,2R)-2-hydroxycyclopentyl]morpholin-4-yl]methanone (PubChem CID 129491728) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-[(1S,2R)-2-hydroxycyclopentyl]morpholin-4-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-[(1S,2R)-2-hydroxycyclopentyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 129491728 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-[(1S,2R)-2-hydroxycyclopentyl]morpholin-4-yl]methanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CCOC[C@@H]3[C@@H]3CCC[C@H]3O)cc2c1C |
| InChI | InChI=1S/C20H26N2O3/c1-12-13(2)21-17-7-6-14(10-16(12)17)20(24)22-8-9-25-11-18(22)15-4-3-5-19(15)23/h6-7,10,15,18-19,21,23H,3-5,8-9,11H2,1-2H3/t15-,18+,19+/m0/s1 |
| InChIKey | XIYXUNOWSMQBIR-KFKAGJAMSA-N |
| XLogP | 2.79 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|