C17H22FNO3 — CID 128987910
(2-fluoro-5-methylphenyl)-[3-(2-hydroxycyclopentyl)morpholin-4-yl]methanone (PubChem CID 128987910) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is (2-fluoro-5-methylphenyl)-[3-(2-hydroxycyclopentyl)morpholin-4-yl]methanone.
| Compound Name | (2-fluoro-5-methylphenyl)-[3-(2-hydroxycyclopentyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 128987910 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2-fluoro-5-methylphenyl)-[3-(2-hydroxycyclopentyl)morpholin-4-yl]methanone |
| SMILES | Cc1ccc(F)c(C(=O)N2CCOCC2C2CCCC2O)c1 |
| InChI | InChI=1S/C17H22FNO3/c1-11-5-6-14(18)13(9-11)17(21)19-7-8-22-10-15(19)12-3-2-4-16(12)20/h5-6,9,12,15-16,20H,2-4,7-8,10H2,1H3 |
| InChIKey | AOYCBQSISFRSFR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |