C19H22N4O2 — CID 110105547
(2,3-dimethyl-1H-indol-5-yl)-[3-(5-methyl-1H-imidazol-2-yl)morpholin-4-yl]methanone (PubChem CID 110105547) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[3-(5-methyl-1H-imidazol-2-yl)morpholin-4-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[3-(5-methyl-1H-imidazol-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110105547 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[3-(5-methyl-1H-imidazol-2-yl)morpholin-4-yl]methanone |
| SMILES | Cc1cnc(C2COCCN2C(=O)c2ccc3[nH]c(C)c(C)c3c2)[nH]1 |
| InChI | InChI=1S/C19H22N4O2/c1-11-9-20-18(21-11)17-10-25-7-6-23(17)19(24)14-4-5-16-15(8-14)12(2)13(3)22-16/h4-5,8-9,17,22H,6-7,10H2,1-3H3,(H,20,21) |
| InChIKey | HMQXOVXFBZAGNX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|