C20H24N4O — CID 125006215
(2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-(5-methyl-1H-imidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 125006215) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-(5-methyl-1H-imidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-(5-methyl-1H-imidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 125006215 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(3S)-3-(5-methyl-1H-imidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cnc([C@H]2CCCN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)C2)[nH]1 |
| InChI | InChI=1S/C20H24N4O/c1-12-10-21-19(22-12)16-5-4-8-24(11-16)20(25)15-6-7-18-17(9-15)13(2)14(3)23-18/h6-7,9-10,16,23H,4-5,8,11H2,1-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | UEPWKKYHLMQMAJ-INIZCTEOSA-N |
| XLogP | 3.84 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|