C21H26N4O — CID 125015112
[(3R)-3-(1,4-dimethylimidazol-2-yl)piperidin-1-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone (PubChem CID 125015112) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is [(3R)-3-(1,4-dimethylimidazol-2-yl)piperidin-1-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone.
| Compound Name | [(3R)-3-(1,4-dimethylimidazol-2-yl)piperidin-1-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 125015112 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(3R)-3-(1,4-dimethylimidazol-2-yl)piperidin-1-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone |
| SMILES | Cc1cn(C)c([C@@H]2CCCN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)C2)n1 |
| InChI | InChI=1S/C21H26N4O/c1-13-11-24(4)20(22-13)17-6-5-9-25(12-17)21(26)16-7-8-19-18(10-16)14(2)15(3)23-19/h7-8,10-11,17,23H,5-6,9,12H2,1-4H3/t17-/m1/s1 |
| InChIKey | WRCQOCFCAVFCAX-QGZVFWFLSA-N |
| XLogP | 3.85 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|