C20H24N4O2 — CID 155983479
[2-(1,4-dimethylimidazol-2-yl)morpholin-4-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone (PubChem CID 155983479) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is [2-(1,4-dimethylimidazol-2-yl)morpholin-4-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone.
| Compound Name | [2-(1,4-dimethylimidazol-2-yl)morpholin-4-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 155983479 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [2-(1,4-dimethylimidazol-2-yl)morpholin-4-yl]-(2,3-dimethyl-1H-indol-5-yl)methanone |
| SMILES | Cc1cn(C)c(C2CN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)CCO2)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-12-10-23(4)19(21-12)18-11-24(7-8-26-18)20(25)15-5-6-17-16(9-15)13(2)14(3)22-17/h5-6,9-10,18,22H,7-8,11H2,1-4H3 |
| InChIKey | MLJCAWGDJMCBAC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|