C17H19ClN4O2 — CID 108569331
2-chloro-1-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazin-1-yl]ethanone (PubChem CID 108569331) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-chloro-1-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108569331 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-chloro-1-[4-(2,3-dimethylquinoxaline-6-carbonyl)piperazin-1-yl]ethanone |
| SMILES | Cc1nc2ccc(C(=O)N3CCN(C(=O)CCl)CC3)cc2nc1C |
| InChI | InChI=1S/C17H19ClN4O2/c1-11-12(2)20-15-9-13(3-4-14(15)19-11)17(24)22-7-5-21(6-8-22)16(23)10-18/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | KARJTNUFARFBCG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|