C30H30N4O4 — CID 135949211
N-(1-benzylpiperidin-4-yl)-2-[(Z)-2-hydroxy-2-(4-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide (PubChem CID 135949211) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[(Z)-2-hydroxy-2-(4-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[(Z)-2-hydroxy-2-(4-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 135949211 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[(Z)-2-hydroxy-2-(4-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide |
| SMILES | COc1ccc(/C(O)=C/c2nc3ccc(C(=O)NC4CCN(Cc5ccccc5)CC4)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C30H30N4O4/c1-38-24-10-7-21(8-11-24)28(35)18-27-30(37)33-26-17-22(9-12-25(26)32-27)29(36)31-23-13-15-34(16-14-23)19-20-5-3-2-4-6-20/h2-12,17-18,23,35H,13-16,19H2,1H3,(H,31,36)(H,33,37)/b28-18- |
| InChIKey | ABZGESHVWROAIK-VEILYXNESA-N |
| XLogP | 4.38 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|