C31H36N4O5 — CID 136847063
ethyl 4-[[2-[2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-3-oxo-4H-quinoxaline-6-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 136847063) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-3-oxo-4H-quinoxaline-6-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-3-oxo-4H-quinoxaline-6-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 136847063 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | ethyl 4-[[2-[2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-3-oxo-4H-quinoxaline-6-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccc3nc(C=C(O)c4ccc(C5CCCCC5)cc4)c(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C31H36N4O5/c1-2-40-31(39)35-16-14-24(15-17-35)32-29(37)23-12-13-25-26(18-23)34-30(38)27(33-25)19-28(36)22-10-8-21(9-11-22)20-6-4-3-5-7-20/h8-13,18-20,24,36H,2-7,14-17H2,1H3,(H,32,37)(H,34,38) |
| InChIKey | SWAWVFWAXMBCRV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|