C25H37N3O4 — CID 39610234
ethyl 4-[4-[(4-cyclohexylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39610234) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is ethyl 4-[4-[(4-cyclohexylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(4-cyclohexylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39610234 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | ethyl 4-[4-[(4-cyclohexylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H37N3O4/c1-2-32-25(31)28-17-14-22(15-18-28)27-23(29)9-6-16-26-24(30)21-12-10-20(11-13-21)19-7-4-3-5-8-19/h10-13,19,22H,2-9,14-18H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | SAFOTHQBJZPGNP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|