C21H31N3O4 — CID 39611649
ethyl 4-[4-[(2,4-dimethylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39611649) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl 4-[4-[(2,4-dimethylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(2,4-dimethylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39611649 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | ethyl 4-[4-[(2,4-dimethylbenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-4-28-21(27)24-12-9-17(10-13-24)23-19(25)6-5-11-22-20(26)18-8-7-15(2)14-16(18)3/h7-8,14,17H,4-6,9-13H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | IOTKAHBVSBXHBA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|