C21H31N3O4 — CID 39611703
ethyl 4-[4-(3-phenylpropanoylamino)butanoylamino]piperidine-1-carboxylate (PubChem CID 39611703) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl 4-[4-(3-phenylpropanoylamino)butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(3-phenylpropanoylamino)butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39611703 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | ethyl 4-[4-(3-phenylpropanoylamino)butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-2-28-21(27)24-15-12-18(13-16-24)23-20(26)9-6-14-22-19(25)11-10-17-7-4-3-5-8-17/h3-5,7-8,18H,2,6,9-16H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FIQAZCBKCYLNHC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|