C26H32N4O5 — CID 39610496
ethyl 4-[4-[(2-benzamidobenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39610496) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is ethyl 4-[4-[(2-benzamidobenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(2-benzamidobenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39610496 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | ethyl 4-[4-[(2-benzamidobenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)c2ccccc2NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O5/c1-2-35-26(34)30-17-14-20(15-18-30)28-23(31)13-8-16-27-25(33)21-11-6-7-12-22(21)29-24(32)19-9-4-3-5-10-19/h3-7,9-12,20H,2,8,13-18H2,1H3,(H,27,33)(H,28,31)(H,29,32) |
| InChIKey | ZIQDAXQQPWXMMQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|