C19H26N4O6 — CID 39611721
ethyl 4-[4-[(4-nitrobenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39611721) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl 4-[4-[(4-nitrobenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(4-nitrobenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39611721 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 4-[4-[(4-nitrobenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H26N4O6/c1-2-29-19(26)22-12-9-15(10-13-22)21-17(24)4-3-11-20-18(25)14-5-7-16(8-6-14)23(27)28/h5-8,15H,2-4,9-13H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | UAZRGTNBAOZKSD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|