C21H28N4O6 — CID 39028814
ethyl 4-[4-[[(E)-3-(2-nitrophenyl)prop-2-enoyl]amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39028814) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 4-[4-[[(E)-3-(2-nitrophenyl)prop-2-enoyl]amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[[(E)-3-(2-nitrophenyl)prop-2-enoyl]amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39028814 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ethyl 4-[4-[[(E)-3-(2-nitrophenyl)prop-2-enoyl]amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCNC(=O)/C=C/c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H28N4O6/c1-2-31-21(28)24-14-11-17(12-15-24)23-20(27)8-5-13-22-19(26)10-9-16-6-3-4-7-18(16)25(29)30/h3-4,6-7,9-10,17H,2,5,8,11-15H2,1H3,(H,22,26)(H,23,27)/b10-9+ |
| InChIKey | CXJZPXCDUJZWMF-MDZDMXLPSA-N |
| XLogP | 2.24 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|