C17H26N6O4 — CID 111034303
ethyl 4-[[N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111034303) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111034303 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 4-[[N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCNc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N6O4/c1-2-27-17(24)22-11-7-13(8-12-22)21-16(18)20-10-9-19-14-5-3-4-6-15(14)23(25)26/h3-6,13,19H,2,7-12H2,1H3,(H3,18,20,21) |
| InChIKey | UWDNEEDJTWLPKW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|