C16H24IN5O4 — CID 111064855
ethyl 4-[[N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111064855) has the molecular formula C16H24IN5O4 and a molecular weight of 477.30 g/mol. Its IUPAC name is ethyl 4-[[N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111064855 |
| Molecular Formula | C16H24IN5O4 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | ethyl 4-[[N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccc([N+](=O)[O-])cc2)CC1.I |
| InChI | InChI=1S/C16H23N5O4.HI/c1-2-25-16(22)20-9-7-13(8-10-20)19-15(17)18-11-12-3-5-14(6-4-12)21(23)24;/h3-6,13H,2,7-11H2,1H3,(H3,17,18,19);1H |
| InChIKey | ZSOMIGJXCOBVHK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|