C20H32N6O3 — CID 111067270
ethyl 4-[[N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111067270) has the molecular formula C20H32N6O3 and a molecular weight of 404.52 g/mol. Its IUPAC name is ethyl 4-[[N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111067270 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | ethyl 4-[[N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccc(NC(=O)NC(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H32N6O3/c1-4-29-20(28)26-11-9-17(10-12-26)24-18(21)22-13-15-5-7-16(8-6-15)25-19(27)23-14(2)3/h5-8,14,17H,4,9-13H2,1-3H3,(H3,21,22,24)(H2,23,25,27) |
| InChIKey | QSQXGNCESGEICI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|