C21H34IN5O3 — CID 111077684
ethyl 4-[[N'-[[3-(3-methylbutanoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111077684) has the molecular formula C21H34IN5O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is ethyl 4-[[N'-[[3-(3-methylbutanoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[[3-(3-methylbutanoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111077684 |
| Molecular Formula | C21H34IN5O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | ethyl 4-[[N'-[[3-(3-methylbutanoylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2cccc(NC(=O)CC(C)C)c2)CC1.I |
| InChI | InChI=1S/C21H33N5O3.HI/c1-4-29-21(28)26-10-8-17(9-11-26)25-20(22)23-14-16-6-5-7-18(13-16)24-19(27)12-15(2)3;/h5-7,13,15,17H,4,8-12,14H2,1-3H3,(H,24,27)(H3,22,23,25);1H |
| InChIKey | MRDAOMKIYIFZGT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|