C18H27F2IN4O3 — CID 111097990
ethyl 4-[[N'-[[3-(2,2-difluoroethoxy)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111097990) has the molecular formula C18H27F2IN4O3 and a molecular weight of 512.34 g/mol. Its IUPAC name is ethyl 4-[[N'-[[3-(2,2-difluoroethoxy)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[[3-(2,2-difluoroethoxy)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111097990 |
| Molecular Formula | C18H27F2IN4O3 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | ethyl 4-[[N'-[[3-(2,2-difluoroethoxy)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2cccc(OCC(F)F)c2)CC1.I |
| InChI | InChI=1S/C18H26F2N4O3.HI/c1-2-26-18(25)24-8-6-14(7-9-24)23-17(21)22-11-13-4-3-5-15(10-13)27-12-16(19)20;/h3-5,10,14,16H,2,6-9,11-12H2,1H3,(H3,21,22,23);1H |
| InChIKey | FWWAPBOFKVUJSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|